C21H32O5 — CID 88845303
2,2-dihydroxy-6-methyl-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]hepta-4,5-dienoic acid (PubChem CID 88845303) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 2,2-dihydroxy-6-methyl-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]hepta-4,5-dienoic acid.
| Compound Name | 2,2-dihydroxy-6-methyl-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]hepta-4,5-dienoic acid |
|---|---|
| PubChem CID | 88845303 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2,2-dihydroxy-6-methyl-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]hepta-4,5-dienoic acid |
| SMILES | CCCCCCC=C[C@H]1CCC(=O)[C@@H]1CC(C)=C=CCC(O)(O)C(=O)O |
| InChI | InChI=1S/C21H32O5/c1-3-4-5-6-7-8-11-17-12-13-19(22)18(17)15-16(2)10-9-14-21(25,26)20(23)24/h8-9,11,17-18,25-26H,3-7,12-15H2,1-2H3,(H,23,24)/t10?,17-,18+/m0/s1 |
| InChIKey | QNCSKUOUMOAEKE-GTQWPPQSSA-N |
| XLogP | 3.76 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|