C21H32O4 — CID 57162282
2,2-dihydroxy-6-methyl-7-[(1R,2S)-2-oct-1-enylcyclopent-3-en-1-yl]hepta-4,5-dienoic acid (PubChem CID 57162282) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 2,2-dihydroxy-6-methyl-7-[(1R,2S)-2-oct-1-enylcyclopent-3-en-1-yl]hepta-4,5-dienoic acid.
| Compound Name | 2,2-dihydroxy-6-methyl-7-[(1R,2S)-2-oct-1-enylcyclopent-3-en-1-yl]hepta-4,5-dienoic acid |
|---|---|
| PubChem CID | 57162282 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2,2-dihydroxy-6-methyl-7-[(1R,2S)-2-oct-1-enylcyclopent-3-en-1-yl]hepta-4,5-dienoic acid |
| SMILES | CCCCCCC=C[C@H]1C=CC[C@@H]1CC(C)=C=CCC(O)(O)C(=O)O |
| InChI | InChI=1S/C21H32O4/c1-3-4-5-6-7-8-12-18-13-9-14-19(18)16-17(2)11-10-15-21(24,25)20(22)23/h8-10,12-13,18-19,24-25H,3-7,14-16H2,1-2H3,(H,22,23)/t11?,18-,19+/m0/s1 |
| InChIKey | JSRBVKUIBGATMZ-BQDKEWAUSA-N |
| XLogP | 4.35 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|