C27H48O3 — CID 70583229
8-[(1S,2R)-2-[(E)-4-ethyl-4-hydroxydec-1-enyl]cyclopent-3-en-1-yl]octyl acetate (PubChem CID 70583229) has the molecular formula C27H48O3 and a molecular weight of 420.68 g/mol. Its IUPAC name is 8-[(1S,2R)-2-[(E)-4-ethyl-4-hydroxydec-1-enyl]cyclopent-3-en-1-yl]octyl acetate.
| Compound Name | 8-[(1S,2R)-2-[(E)-4-ethyl-4-hydroxydec-1-enyl]cyclopent-3-en-1-yl]octyl acetate |
|---|---|
| PubChem CID | 70583229 |
| Molecular Formula | C27H48O3 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.36 |
| IUPAC Name | 8-[(1S,2R)-2-[(E)-4-ethyl-4-hydroxydec-1-enyl]cyclopent-3-en-1-yl]octyl acetate |
| SMILES | CCCCCCC(O)(CC)C/C=C/[C@H]1C=CC[C@@H]1CCCCCCCCOC(C)=O |
| InChI | InChI=1S/C27H48O3/c1-4-6-7-13-21-27(29,5-2)22-16-20-26-19-15-18-25(26)17-12-10-8-9-11-14-23-30-24(3)28/h15-16,19-20,25-26,29H,4-14,17-18,21-23H2,1-3H3/b20-16+/t25-,26+,27?/m0/s1 |
| InChIKey | AZOWHMBSPSJSIL-QQFJJESSSA-N |
| XLogP | 7.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|