C28H48O3 — CID 70581479
8-[(1S,2R)-2-[(E)-4-cyclopropyl-4-hydroxydec-1-enyl]cyclopent-3-en-1-yl]octyl acetate (PubChem CID 70581479) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is 8-[(1S,2R)-2-[(E)-4-cyclopropyl-4-hydroxydec-1-enyl]cyclopent-3-en-1-yl]octyl acetate.
| Compound Name | 8-[(1S,2R)-2-[(E)-4-cyclopropyl-4-hydroxydec-1-enyl]cyclopent-3-en-1-yl]octyl acetate |
|---|---|
| PubChem CID | 70581479 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | 8-[(1S,2R)-2-[(E)-4-cyclopropyl-4-hydroxydec-1-enyl]cyclopent-3-en-1-yl]octyl acetate |
| SMILES | CCCCCCC(O)(C/C=C/[C@H]1C=CC[C@@H]1CCCCCCCCOC(C)=O)C1CC1 |
| InChI | InChI=1S/C28H48O3/c1-3-4-5-11-21-28(30,27-19-20-27)22-14-18-26-17-13-16-25(26)15-10-8-6-7-9-12-23-31-24(2)29/h13-14,17-18,25-27,30H,3-12,15-16,19-23H2,1-2H3/b18-14+/t25-,26+,28?/m0/s1 |
| InChIKey | BOTIXXBQPCNKMY-BZUNCDOYSA-N |
| XLogP | 7.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|