C25H42O3 — CID 70582420
8-[(1S,2R)-2-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]cyclopent-3-en-1-yl]octyl acetate (PubChem CID 70582420) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 8-[(1S,2R)-2-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]cyclopent-3-en-1-yl]octyl acetate.
| Compound Name | 8-[(1S,2R)-2-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]cyclopent-3-en-1-yl]octyl acetate |
|---|---|
| PubChem CID | 70582420 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 8-[(1S,2R)-2-[(E)-4-ethenyl-4-hydroxyoct-1-enyl]cyclopent-3-en-1-yl]octyl acetate |
| SMILES | C=CC(O)(C/C=C/[C@H]1C=CC[C@@H]1CCCCCCCCOC(C)=O)CCCC |
| InChI | InChI=1S/C25H42O3/c1-4-6-19-25(27,5-2)20-14-18-24-17-13-16-23(24)15-11-9-7-8-10-12-21-28-22(3)26/h5,13-14,17-18,23-24,27H,2,4,6-12,15-16,19-21H2,1,3H3/b18-14+/t23-,24+,25?/m0/s1 |
| InChIKey | PNOOCNCDERZIDO-JIZAKHHASA-N |
| XLogP | 6.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|