C21H36O2 — CID 163523544
methyl 7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopent-3-en-1-yl]heptanoate (PubChem CID 163523544) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is methyl 7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopent-3-en-1-yl]heptanoate.
| Compound Name | methyl 7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopent-3-en-1-yl]heptanoate |
|---|---|
| PubChem CID | 163523544 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | methyl 7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopent-3-en-1-yl]heptanoate |
| SMILES | CCCCCC/C=C/[C@H]1C=CC[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H36O2/c1-3-4-5-6-7-10-14-19-16-13-17-20(19)15-11-8-9-12-18-21(22)23-2/h10,13-14,16,19-20H,3-9,11-12,15,17-18H2,1-2H3/b14-10+/t19-,20-/m0/s1 |
| InChIKey | DMVUGKLXEVVSDX-GUERIMHUSA-N |
| XLogP | 6.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|