C21H36 — CID 57204921
(3S,4S)-3-oct-1-enyl-4-oct-2-enylcyclopentene (PubChem CID 57204921) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is (3S,4S)-3-oct-1-enyl-4-oct-2-enylcyclopentene.
| Compound Name | (3S,4S)-3-oct-1-enyl-4-oct-2-enylcyclopentene |
|---|---|
| PubChem CID | 57204921 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | (3S,4S)-3-oct-1-enyl-4-oct-2-enylcyclopentene |
| SMILES | CCCCCC=CC[C@H]1CC=C[C@@H]1C=CCCCCCC |
| InChI | InChI=1S/C21H36/c1-3-5-7-9-11-13-16-20-18-15-19-21(20)17-14-12-10-8-6-4-2/h11,13-15,17,19-21H,3-10,12,16,18H2,1-2H3/t20-,21-/m0/s1 |
| InChIKey | MWZWFSNQMIEOGU-SFTDATJTSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|