C23H40O2 — CID 54523599
8-[(1S,2S)-2-deca-1,5-dienylcyclopent-3-en-1-yl]octane-1,2-diol (PubChem CID 54523599) has the molecular formula C23H40O2 and a molecular weight of 348.57 g/mol. Its IUPAC name is 8-[(1S,2S)-2-deca-1,5-dienylcyclopent-3-en-1-yl]octane-1,2-diol.
| Compound Name | 8-[(1S,2S)-2-deca-1,5-dienylcyclopent-3-en-1-yl]octane-1,2-diol |
|---|---|
| PubChem CID | 54523599 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | 8-[(1S,2S)-2-deca-1,5-dienylcyclopent-3-en-1-yl]octane-1,2-diol |
| SMILES | CCCCC=CCCC=C[C@H]1C=CC[C@@H]1CCCCCCC(O)CO |
| InChI | InChI=1S/C23H40O2/c1-2-3-4-5-6-7-8-11-15-21-17-14-18-22(21)16-12-9-10-13-19-23(25)20-24/h5-6,11,14-15,17,21-25H,2-4,7-10,12-13,16,18-20H2,1H3/t21-,22-,23?/m0/s1 |
| InChIKey | YROGEDYWTFUTNS-OJSMNCEXSA-N |
| XLogP | 5.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|