C22H38O2 — CID 70581480
8-[(1S,2R)-2-[(4S)-4-methylocta-1,5-dienyl]cyclopent-3-en-1-yl]octane-1,2-diol (PubChem CID 70581480) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 8-[(1S,2R)-2-[(4S)-4-methylocta-1,5-dienyl]cyclopent-3-en-1-yl]octane-1,2-diol.
| Compound Name | 8-[(1S,2R)-2-[(4S)-4-methylocta-1,5-dienyl]cyclopent-3-en-1-yl]octane-1,2-diol |
|---|---|
| PubChem CID | 70581480 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 8-[(1S,2R)-2-[(4S)-4-methylocta-1,5-dienyl]cyclopent-3-en-1-yl]octane-1,2-diol |
| SMILES | CCC=C[C@@H](C)CC=C[C@H]1C=CC[C@@H]1CCCCCCC(O)CO |
| InChI | InChI=1S/C22H38O2/c1-3-4-11-19(2)12-9-14-21-16-10-15-20(21)13-7-5-6-8-17-22(24)18-23/h4,9-11,14,16,19-24H,3,5-8,12-13,15,17-18H2,1-2H3/t19-,20+,21+,22?/m1/s1 |
| InChIKey | DELROOJAPJIRFK-ZPHWTRHBSA-N |
| XLogP | 5.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|