C26H46O3 — CID 54361412
[2-hydroxy-8-[(1S,2R)-2-[(4R)-4-methyldec-1-enyl]cyclopent-3-en-1-yl]octyl] acetate (PubChem CID 54361412) has the molecular formula C26H46O3 and a molecular weight of 406.65 g/mol. Its IUPAC name is [2-hydroxy-8-[(1S,2R)-2-[(4R)-4-methyldec-1-enyl]cyclopent-3-en-1-yl]octyl] acetate.
| Compound Name | [2-hydroxy-8-[(1S,2R)-2-[(4R)-4-methyldec-1-enyl]cyclopent-3-en-1-yl]octyl] acetate |
|---|---|
| PubChem CID | 54361412 |
| Molecular Formula | C26H46O3 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.34 |
| IUPAC Name | [2-hydroxy-8-[(1S,2R)-2-[(4R)-4-methyldec-1-enyl]cyclopent-3-en-1-yl]octyl] acetate |
| SMILES | CCCCCC[C@@H](C)CC=C[C@H]1C=CC[C@@H]1CCCCCCC(O)COC(C)=O |
| InChI | InChI=1S/C26H46O3/c1-4-5-6-9-14-22(2)15-12-17-25-19-13-18-24(25)16-10-7-8-11-20-26(28)21-29-23(3)27/h12-13,17,19,22,24-26,28H,4-11,14-16,18,20-21H2,1-3H3/t22-,24+,25+,26?/m1/s1 |
| InChIKey | UMTRTDGKXQLFBY-UZGMISGMSA-N |
| XLogP | 7.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|