C26H44O2 — CID 54105015
2-ethenyl-8-[(1S,2R)-2-[(4S)-4-methyldeca-1,5-dienyl]cyclopent-3-en-1-yl]octane-1,2-diol (PubChem CID 54105015) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is 2-ethenyl-8-[(1S,2R)-2-[(4S)-4-methyldeca-1,5-dienyl]cyclopent-3-en-1-yl]octane-1,2-diol.
| Compound Name | 2-ethenyl-8-[(1S,2R)-2-[(4S)-4-methyldeca-1,5-dienyl]cyclopent-3-en-1-yl]octane-1,2-diol |
|---|---|
| PubChem CID | 54105015 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 2-ethenyl-8-[(1S,2R)-2-[(4S)-4-methyldeca-1,5-dienyl]cyclopent-3-en-1-yl]octane-1,2-diol |
| SMILES | C=CC(O)(CO)CCCCCC[C@H]1CC=C[C@@H]1C=CC[C@H](C)C=CCCCC |
| InChI | InChI=1S/C26H44O2/c1-4-6-7-10-15-23(3)16-13-18-25-20-14-19-24(25)17-11-8-9-12-21-26(28,5-2)22-27/h5,10,13-15,18,20,23-25,27-28H,2,4,6-9,11-12,16-17,19,21-22H2,1,3H3/t23-,24+,25+,26?/m1/s1 |
| InChIKey | NDDHNOHGGDJKBT-VHNWMKGBSA-N |
| XLogP | 6.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|