C16H26O2 — CID 123619501
5-(5,6-dimethylcyclohex-3-en-1-yl)pentyl prop-2-enoate (PubChem CID 123619501) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 5-(5,6-dimethylcyclohex-3-en-1-yl)pentyl prop-2-enoate.
| Compound Name | 5-(5,6-dimethylcyclohex-3-en-1-yl)pentyl prop-2-enoate |
|---|---|
| PubChem CID | 123619501 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 5-(5,6-dimethylcyclohex-3-en-1-yl)pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCC1CC=CC(C)C1C |
| InChI | InChI=1S/C16H26O2/c1-4-16(17)18-12-7-5-6-10-15-11-8-9-13(2)14(15)3/h4,8-9,13-15H,1,5-7,10-12H2,2-3H3 |
| InChIKey | DLAFJYAKELZRJO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|