C23H40O5 — CID 57302471
7-[(1S,2S,3R)-2-(4-ethenyl-4-hydroxynon-1-enyl)-3-hydroxycyclopentyl]-3-hydroxyheptanoic acid (PubChem CID 57302471) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is 7-[(1S,2S,3R)-2-(4-ethenyl-4-hydroxynon-1-enyl)-3-hydroxycyclopentyl]-3-hydroxyheptanoic acid.
| Compound Name | 7-[(1S,2S,3R)-2-(4-ethenyl-4-hydroxynon-1-enyl)-3-hydroxycyclopentyl]-3-hydroxyheptanoic acid |
|---|---|
| PubChem CID | 57302471 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 7-[(1S,2S,3R)-2-(4-ethenyl-4-hydroxynon-1-enyl)-3-hydroxycyclopentyl]-3-hydroxyheptanoic acid |
| SMILES | C=CC(O)(CC=C[C@@H]1[C@@H](CCCCC(O)CC(=O)O)CC[C@H]1O)CCCCC |
| InChI | InChI=1S/C23H40O5/c1-3-5-8-15-23(28,4-2)16-9-12-20-18(13-14-21(20)25)10-6-7-11-19(24)17-22(26)27/h4,9,12,18-21,24-25,28H,2-3,5-8,10-11,13-17H2,1H3,(H,26,27)/t18-,19?,20+,21+,23?/m0/s1 |
| InChIKey | OMNMQHDXHUUNRB-UJZPQSMSSA-N |
| XLogP | 4.21 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|