C22H42O5 — CID 57295914
3-hydroxy-7-[(1S,2R,3R)-3-hydroxy-2-(3-hydroxy-4,4-dimethyloctyl)cyclopentyl]heptanoic acid (PubChem CID 57295914) has the molecular formula C22H42O5 and a molecular weight of 386.57 g/mol. Its IUPAC name is 3-hydroxy-7-[(1S,2R,3R)-3-hydroxy-2-(3-hydroxy-4,4-dimethyloctyl)cyclopentyl]heptanoic acid.
| Compound Name | 3-hydroxy-7-[(1S,2R,3R)-3-hydroxy-2-(3-hydroxy-4,4-dimethyloctyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 57295914 |
| Molecular Formula | C22H42O5 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | 3-hydroxy-7-[(1S,2R,3R)-3-hydroxy-2-(3-hydroxy-4,4-dimethyloctyl)cyclopentyl]heptanoic acid |
| SMILES | CCCCC(C)(C)C(O)CC[C@@H]1[C@@H](CCCCC(O)CC(=O)O)CC[C@H]1O |
| InChI | InChI=1S/C22H42O5/c1-4-5-14-22(2,3)20(25)13-11-18-16(10-12-19(18)24)8-6-7-9-17(23)15-21(26)27/h16-20,23-25H,4-15H2,1-3H3,(H,26,27)/t16-,17?,18+,19+,20?/m0/s1 |
| InChIKey | VOEAWEJXMSIUKJ-DQAKRJAASA-N |
| XLogP | 4.13 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|