C21H36O6 — CID 54370286
7-[(1R,2R,3R,5R)-2-(4-formyl-4-hydroxyoct-1-enyl)-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 54370286) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5R)-2-(4-formyl-4-hydroxyoct-1-enyl)-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5R)-2-(4-formyl-4-hydroxyoct-1-enyl)-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54370286 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 7-[(1R,2R,3R,5R)-2-(4-formyl-4-hydroxyoct-1-enyl)-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | CCCCC(O)(C=O)CC=C[C@@H]1[C@@H](CCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C21H36O6/c1-2-3-12-21(27,15-22)13-8-10-17-16(18(23)14-19(17)24)9-6-4-5-7-11-20(25)26/h8,10,15-19,23-24,27H,2-7,9,11-14H2,1H3,(H,25,26)/t16-,17-,18-,19-,21?/m1/s1 |
| InChIKey | USSHUAYWQOMIES-RBTJGNDVSA-N |
| XLogP | 2.84 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|