C20H32O2 — CID 54359075
6-(7-hept-1-enylcyclohepta-2,5-dien-1-yl)hexanoic acid (PubChem CID 54359075) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 6-(7-hept-1-enylcyclohepta-2,5-dien-1-yl)hexanoic acid.
| Compound Name | 6-(7-hept-1-enylcyclohepta-2,5-dien-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 54359075 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 6-(7-hept-1-enylcyclohepta-2,5-dien-1-yl)hexanoic acid |
| SMILES | CCCCCC=CC1C=CCC=CC1CCCCCC(=O)O |
| InChI | InChI=1S/C20H32O2/c1-2-3-4-5-8-13-18-14-9-6-10-15-19(18)16-11-7-12-17-20(21)22/h8-10,13-15,18-19H,2-7,11-12,16-17H2,1H3,(H,21,22) |
| InChIKey | ULEMTFHTZLJASZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|