C16H24O2 — CID 101176098
6-[6-[(Z)-but-1-enyl]cyclohexa-2,4-dien-1-yl]hexanoic acid (PubChem CID 101176098) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 6-[6-[(Z)-but-1-enyl]cyclohexa-2,4-dien-1-yl]hexanoic acid.
| Compound Name | 6-[6-[(Z)-but-1-enyl]cyclohexa-2,4-dien-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 101176098 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 6-[6-[(Z)-but-1-enyl]cyclohexa-2,4-dien-1-yl]hexanoic acid |
| SMILES | CC/C=C\C1C=CC=CC1CCCCCC(=O)O |
| InChI | InChI=1S/C16H24O2/c1-2-3-9-14-11-7-8-12-15(14)10-5-4-6-13-16(17)18/h3,7-9,11-12,14-15H,2,4-6,10,13H2,1H3,(H,17,18)/b9-3- |
| InChIKey | PPBZKAACRSCBOS-OQFOIZHKSA-N |
| XLogP | 4.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|