C36H64O4 — CID 20746277
8-[5-(7-carboxyheptyl)-4-hexyl-6-[(E)-oct-1-enyl]cyclohex-2-en-1-yl]octanoic acid (PubChem CID 20746277) has the molecular formula C36H64O4 and a molecular weight of 560.90 g/mol. Its IUPAC name is 8-[5-(7-carboxyheptyl)-4-hexyl-6-[(E)-oct-1-enyl]cyclohex-2-en-1-yl]octanoic acid.
| Compound Name | 8-[5-(7-carboxyheptyl)-4-hexyl-6-[(E)-oct-1-enyl]cyclohex-2-en-1-yl]octanoic acid |
|---|---|
| PubChem CID | 20746277 |
| Molecular Formula | C36H64O4 |
| Molecular Weight | 560.90 g/mol |
| Exact Mass | 560.48 |
| IUPAC Name | 8-[5-(7-carboxyheptyl)-4-hexyl-6-[(E)-oct-1-enyl]cyclohex-2-en-1-yl]octanoic acid |
| SMILES | CCCCCC/C=C/C1C(CCCCCCCC(=O)O)C=CC(CCCCCC)C1CCCCCCCC(=O)O |
| InChI | InChI=1S/C36H64O4/c1-3-5-7-9-13-19-25-34-32(24-18-12-10-15-21-27-35(37)38)30-29-31(23-17-8-6-4-2)33(34)26-20-14-11-16-22-28-36(39)40/h19,25,29-34H,3-18,20-24,26-28H2,1-2H3,(H,37,38)(H,39,40)/b25-19+ |
| InChIKey | JPUZBFZKTMCPLJ-NCELDCMTSA-N |
| XLogP | 11.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.90 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|