C48H86O6 — CID 129273042
8-[7,8-bis(7-carboxyheptyl)-6-ethyl-4,5-dihexyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]octanoic acid (PubChem CID 129273042) has the molecular formula C48H86O6 and a molecular weight of 759.21 g/mol. Its IUPAC name is 8-[7,8-bis(7-carboxyheptyl)-6-ethyl-4,5-dihexyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]octanoic acid.
| Compound Name | 8-[7,8-bis(7-carboxyheptyl)-6-ethyl-4,5-dihexyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]octanoic acid |
|---|---|
| PubChem CID | 129273042 |
| Molecular Formula | C48H86O6 |
| Molecular Weight | 759.21 g/mol |
| Exact Mass | 758.64 |
| IUPAC Name | 8-[7,8-bis(7-carboxyheptyl)-6-ethyl-4,5-dihexyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]octanoic acid |
| SMILES | CCCCCCC1C=CC(CCCCCCCC(=O)O)C2C(CCCCCCCC(=O)O)C(CCCCCCCC(=O)O)C(CC)C(CCCCCC)C12 |
| InChI | InChI=1S/C48H86O6/c1-4-7-9-20-28-38-36-37-39(29-21-14-11-17-25-33-44(49)50)48-43(32-24-16-13-19-27-35-46(53)54)41(30-23-15-12-18-26-34-45(51)52)40(6-3)42(47(38)48)31-22-10-8-5-2/h36-43,47-48H,4-35H2,1-3H3,(H,49,50)(H,51,52)(H,53,54) |
| InChIKey | LQLGXKUDNIAQNM-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.21 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|