C38H68O4 — CID 139890908
9-[6-(8-carboxyoctyl)-4-hexyl-5-oct-1-enylcyclohex-2-en-1-yl]nonanoic acid (PubChem CID 139890908) has the molecular formula C38H68O4 and a molecular weight of 588.96 g/mol. Its IUPAC name is 9-[6-(8-carboxyoctyl)-4-hexyl-5-oct-1-enylcyclohex-2-en-1-yl]nonanoic acid.
| Compound Name | 9-[6-(8-carboxyoctyl)-4-hexyl-5-oct-1-enylcyclohex-2-en-1-yl]nonanoic acid |
|---|---|
| PubChem CID | 139890908 |
| Molecular Formula | C38H68O4 |
| Molecular Weight | 588.96 g/mol |
| Exact Mass | 588.51 |
| IUPAC Name | 9-[6-(8-carboxyoctyl)-4-hexyl-5-oct-1-enylcyclohex-2-en-1-yl]nonanoic acid |
| SMILES | CCCCCCC=CC1C(CCCCCC)C=CC(CCCCCCCCC(=O)O)C1CCCCCCCCC(=O)O |
| InChI | InChI=1S/C38H68O4/c1-3-5-7-9-15-21-27-35-33(25-19-8-6-4-2)31-32-34(26-20-14-10-12-17-23-29-37(39)40)36(35)28-22-16-11-13-18-24-30-38(41)42/h21,27,31-36H,3-20,22-26,28-30H2,1-2H3,(H,39,40)(H,41,42) |
| InChIKey | UHQQNXAWTBWJAQ-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.96 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|