C20H30O4 — CID 54301011
2,2-dihydroxy-7-(2-oct-1-enylcyclopenten-1-yl)hepta-4,5-dienoic acid (PubChem CID 54301011) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2,2-dihydroxy-7-(2-oct-1-enylcyclopenten-1-yl)hepta-4,5-dienoic acid.
| Compound Name | 2,2-dihydroxy-7-(2-oct-1-enylcyclopenten-1-yl)hepta-4,5-dienoic acid |
|---|---|
| PubChem CID | 54301011 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2,2-dihydroxy-7-(2-oct-1-enylcyclopenten-1-yl)hepta-4,5-dienoic acid |
| SMILES | CCCCCCC=CC1=C(CC=C=CCC(O)(O)C(=O)O)CCC1 |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-6-8-12-17-14-11-15-18(17)13-9-7-10-16-20(23,24)19(21)22/h8-10,12,23-24H,2-6,11,13-16H2,1H3,(H,21,22) |
| InChIKey | SEDVRJZMINTQDS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|