C22H36O2 — CID 57202369
7-[(5S)-5-ethyl-2-oct-1-enylcyclopenten-1-yl]hepta-4,5-diene-1,1-diol (PubChem CID 57202369) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 7-[(5S)-5-ethyl-2-oct-1-enylcyclopenten-1-yl]hepta-4,5-diene-1,1-diol.
| Compound Name | 7-[(5S)-5-ethyl-2-oct-1-enylcyclopenten-1-yl]hepta-4,5-diene-1,1-diol |
|---|---|
| PubChem CID | 57202369 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 7-[(5S)-5-ethyl-2-oct-1-enylcyclopenten-1-yl]hepta-4,5-diene-1,1-diol |
| SMILES | CCCCCCC=CC1=C(CC=C=CCCC(O)O)[C@@H](CC)CC1 |
| InChI | InChI=1S/C22H36O2/c1-3-5-6-7-8-11-14-20-18-17-19(4-2)21(20)15-12-9-10-13-16-22(23)24/h10-12,14,19,22-24H,3-8,13,15-18H2,1-2H3/t9?,19-/m0/s1 |
| InChIKey | DOUKAEFGDZEPHP-YOKAEFACSA-N |
| XLogP | 5.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|