About dodec-8-ene-1,1-diol
dodec-8-ene-1,1-diol (PubChem CID 90860381) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is dodec-8-ene-1,1-diol.
Molecular Properties
| Compound Name | dodec-8-ene-1,1-diol |
| PubChem CID | 90860381 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | dodec-8-ene-1,1-diol |
| SMILES | CCCC=CCCCCCCC(O)O |
| InChI | InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h4-5,12-14H,2-3,6-11H2,1H3 |
| InChIKey | JGDOTUMEMIGOBP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dodec-8-ene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-8-ene-1,1-diol?
The IUPAC name of dodec-8-ene-1,1-diol (CID 90860381) is dodec-8-ene-1,1-diol.
What is the SMILES notation for dodec-8-ene-1,1-diol?
The canonical SMILES for dodec-8-ene-1,1-diol is CCCC=CCCCCCCC(O)O.
What is the InChIKey of dodec-8-ene-1,1-diol?
The InChIKey is JGDOTUMEMIGOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h4-5,12-14H,2-3,6-11H2,1H3.
What are the key properties of dodec-8-ene-1,1-diol?
dodec-8-ene-1,1-diol has a molecular weight of 200.32 g/mol, XLogP of 2.99, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-8-ene-1,1-diol is sourced from PubChem (CID 90860381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).