C23H36O4 — CID 57096407
2,2-dihydroxy-4,6-dimethyl-7-[(5S)-5-methyl-2-oct-1-enylcyclopenten-1-yl]hepta-4,5-dienoic acid (PubChem CID 57096407) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2,2-dihydroxy-4,6-dimethyl-7-[(5S)-5-methyl-2-oct-1-enylcyclopenten-1-yl]hepta-4,5-dienoic acid.
| Compound Name | 2,2-dihydroxy-4,6-dimethyl-7-[(5S)-5-methyl-2-oct-1-enylcyclopenten-1-yl]hepta-4,5-dienoic acid |
|---|---|
| PubChem CID | 57096407 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 2,2-dihydroxy-4,6-dimethyl-7-[(5S)-5-methyl-2-oct-1-enylcyclopenten-1-yl]hepta-4,5-dienoic acid |
| SMILES | CCCCCCC=CC1=C(CC(C)=C=C(C)CC(O)(O)C(=O)O)[C@@H](C)CC1 |
| InChI | InChI=1S/C23H36O4/c1-5-6-7-8-9-10-11-20-13-12-19(4)21(20)15-17(2)14-18(3)16-23(26,27)22(24)25/h10-11,19,26-27H,5-9,12-13,15-16H2,1-4H3,(H,24,25)/t14?,19-/m0/s1 |
| InChIKey | XKSSBBODCXMFSD-PKDNWHCCSA-N |
| XLogP | 5.28 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|