C22H41NO4 — CID 141136168
2-methyl-2-[[(Z)-octadec-9-enyl]amino]propanedioic acid (PubChem CID 141136168) has the molecular formula C22H41NO4 and a molecular weight of 383.57 g/mol. Its IUPAC name is 2-methyl-2-[[(Z)-octadec-9-enyl]amino]propanedioic acid.
| Compound Name | 2-methyl-2-[[(Z)-octadec-9-enyl]amino]propanedioic acid |
|---|---|
| PubChem CID | 141136168 |
| Molecular Formula | C22H41NO4 |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.30 |
| IUPAC Name | 2-methyl-2-[[(Z)-octadec-9-enyl]amino]propanedioic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(C)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H41NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-22(2,20(24)25)21(26)27/h10-11,23H,3-9,12-19H2,1-2H3,(H,24,25)(H,26,27)/b11-10- |
| InChIKey | PLSGYPLWJGBUCR-KHPPLWFESA-N |
| XLogP | 5.54 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|