C24H38O4 — CID 88846269
methyl 2,2-dihydroxy-7-[2-[(E)-oct-1-enyl]cyclopenten-1-yl]-3-propylhepta-4,5-dienoate (PubChem CID 88846269) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is methyl 2,2-dihydroxy-7-[2-[(E)-oct-1-enyl]cyclopenten-1-yl]-3-propylhepta-4,5-dienoate.
| Compound Name | methyl 2,2-dihydroxy-7-[2-[(E)-oct-1-enyl]cyclopenten-1-yl]-3-propylhepta-4,5-dienoate |
|---|---|
| PubChem CID | 88846269 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | methyl 2,2-dihydroxy-7-[2-[(E)-oct-1-enyl]cyclopenten-1-yl]-3-propylhepta-4,5-dienoate |
| SMILES | CCCCCC/C=C/C1=C(CC=C=CC(CCC)C(O)(O)C(=O)OC)CCC1 |
| InChI | InChI=1S/C24H38O4/c1-4-6-7-8-9-10-15-20-17-13-18-21(20)16-11-12-19-22(14-5-2)24(26,27)23(25)28-3/h10-11,15,19,22,26-27H,4-9,13-14,16-18H2,1-3H3/b15-10+ |
| InChIKey | AOZRYJCFFXXQLJ-XNTDXEJSSA-N |
| XLogP | 5.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|