C31H60O4 — CID 141220667
(1,1-dihydroxy-2-methyldodecyl) (Z)-octadec-9-enoate (PubChem CID 141220667) has the molecular formula C31H60O4 and a molecular weight of 496.82 g/mol. Its IUPAC name is (1,1-dihydroxy-2-methyldodecyl) (Z)-octadec-9-enoate.
| Compound Name | (1,1-dihydroxy-2-methyldodecyl) (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 141220667 |
| Molecular Formula | C31H60O4 |
| Molecular Weight | 496.82 g/mol |
| Exact Mass | 496.45 |
| IUPAC Name | (1,1-dihydroxy-2-methyldodecyl) (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(O)(O)C(C)CCCCCCCCCC |
| InChI | InChI=1S/C31H60O4/c1-4-6-8-10-12-14-15-16-17-18-19-20-22-24-26-28-30(32)35-31(33,34)29(3)27-25-23-21-13-11-9-7-5-2/h16-17,29,33-34H,4-15,18-28H2,1-3H3/b17-16- |
| InChIKey | OSUYLSNDBJFAGJ-MSUUIHNZSA-N |
| XLogP | 9.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.82 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|