C23H36O4 — CID 57252041
methyl 7-[(1S,2S,5S)-2-ethyl-5-oct-1-enylcyclopent-3-en-1-yl]-2,2-dihydroxyhepta-4,5-dienoate (PubChem CID 57252041) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is methyl 7-[(1S,2S,5S)-2-ethyl-5-oct-1-enylcyclopent-3-en-1-yl]-2,2-dihydroxyhepta-4,5-dienoate.
| Compound Name | methyl 7-[(1S,2S,5S)-2-ethyl-5-oct-1-enylcyclopent-3-en-1-yl]-2,2-dihydroxyhepta-4,5-dienoate |
|---|---|
| PubChem CID | 57252041 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | methyl 7-[(1S,2S,5S)-2-ethyl-5-oct-1-enylcyclopent-3-en-1-yl]-2,2-dihydroxyhepta-4,5-dienoate |
| SMILES | CCCCCCC=C[C@H]1C=C[C@H](CC)[C@@H]1CC=C=CCC(O)(O)C(=O)OC |
| InChI | InChI=1S/C23H36O4/c1-4-6-7-8-9-11-14-20-17-16-19(5-2)21(20)15-12-10-13-18-23(25,26)22(24)27-3/h11-14,16-17,19-21,25-26H,4-9,15,18H2,1-3H3/t10?,19-,20-,21-/m0/s1 |
| InChIKey | HYINNHBHCQIBJF-OQQHKOOGSA-N |
| XLogP | 4.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|