C21H30O4 — CID 57271561
2-hydroxy-3-methyl-7-[(1R,2S)-2-oct-1-enyl-5-oxocyclopent-3-en-1-yl]hepta-4,5-dienoic acid (PubChem CID 57271561) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-7-[(1R,2S)-2-oct-1-enyl-5-oxocyclopent-3-en-1-yl]hepta-4,5-dienoic acid.
| Compound Name | 2-hydroxy-3-methyl-7-[(1R,2S)-2-oct-1-enyl-5-oxocyclopent-3-en-1-yl]hepta-4,5-dienoic acid |
|---|---|
| PubChem CID | 57271561 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-hydroxy-3-methyl-7-[(1R,2S)-2-oct-1-enyl-5-oxocyclopent-3-en-1-yl]hepta-4,5-dienoic acid |
| SMILES | CCCCCCC=C[C@H]1C=CC(=O)[C@@H]1CC=C=CC(C)C(O)C(=O)O |
| InChI | InChI=1S/C21H30O4/c1-3-4-5-6-7-8-12-17-14-15-19(22)18(17)13-10-9-11-16(2)20(23)21(24)25/h8,10-12,14-18,20,23H,3-7,13H2,1-2H3,(H,24,25)/t9?,16?,17-,18+,20?/m0/s1 |
| InChIKey | BDMZLJTXRNQKGG-QJRPLUPOSA-N |
| XLogP | 4.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|