C17H28O2 — CID 70405925
5-(1-hydroxybutyl)-4-[(E)-oct-1-enyl]cyclopent-2-en-1-one (PubChem CID 70405925) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 5-(1-hydroxybutyl)-4-[(E)-oct-1-enyl]cyclopent-2-en-1-one.
| Compound Name | 5-(1-hydroxybutyl)-4-[(E)-oct-1-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 70405925 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 5-(1-hydroxybutyl)-4-[(E)-oct-1-enyl]cyclopent-2-en-1-one |
| SMILES | CCCCCC/C=C/C1C=CC(=O)C1C(O)CCC |
| InChI | InChI=1S/C17H28O2/c1-3-5-6-7-8-9-11-14-12-13-16(19)17(14)15(18)10-4-2/h9,11-15,17-18H,3-8,10H2,1-2H3/b11-9+ |
| InChIKey | JIRJBIVRXSKVKL-PKNBQFBNSA-N |
| XLogP | 4.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|