C14H22O3 — CID 101053591
(2S)-2-[(E,1S)-1-hydroxydec-4-enyl]-2H-furan-5-one (PubChem CID 101053591) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2S)-2-[(E,1S)-1-hydroxydec-4-enyl]-2H-furan-5-one.
| Compound Name | (2S)-2-[(E,1S)-1-hydroxydec-4-enyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 101053591 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2S)-2-[(E,1S)-1-hydroxydec-4-enyl]-2H-furan-5-one |
| SMILES | CCCCC/C=C/CC[C@H](O)[C@@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C14H22O3/c1-2-3-4-5-6-7-8-9-12(15)13-10-11-14(16)17-13/h6-7,10-13,15H,2-5,8-9H2,1H3/b7-6+/t12-,13-/m0/s1 |
| InChIKey | ZEGMTNGNQUOVQU-XKZLPGLHSA-N |
| XLogP | 2.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|