C20H28O — CID 11231456
(1S,2S)-2-[(E)-dec-1-enyl]-1,2-dihydronaphthalen-1-ol (PubChem CID 11231456) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (1S,2S)-2-[(E)-dec-1-enyl]-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1S,2S)-2-[(E)-dec-1-enyl]-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 11231456 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (1S,2S)-2-[(E)-dec-1-enyl]-1,2-dihydronaphthalen-1-ol |
| SMILES | CCCCCCCC/C=C/[C@H]1C=Cc2ccccc2[C@H]1O |
| InChI | InChI=1S/C20H28O/c1-2-3-4-5-6-7-8-9-13-18-16-15-17-12-10-11-14-19(17)20(18)21/h9-16,18,20-21H,2-8H2,1H3/b13-9+/t18-,20-/m0/s1 |
| InChIKey | AIICAKOUERDJIB-LMRKYDFJSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|