About 1-butyl-1H-indene;zirconium
1-butyl-1H-indene;zirconium (PubChem CID 175289141) has the molecular formula C13H16Zr
and a molecular weight of 263.50 g/mol. Its IUPAC name is 1-butyl-1H-indene;zirconium.
Molecular Properties
| Compound Name | 1-butyl-1H-indene;zirconium |
| PubChem CID | 175289141 |
| Molecular Formula | C13H16Zr |
| Molecular Weight | 263.50 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 1-butyl-1H-indene;zirconium |
| SMILES | CCCCC1C=Cc2ccccc21.[Zr] |
| InChI | InChI=1S/C13H16.Zr/c1-2-3-6-11-9-10-12-7-4-5-8-13(11)12;/h4-5,7-11H,2-3,6H2,1H3; |
| InChIKey | XQKHTLXNHMPANS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyl-1H-indene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1H-indene;zirconium?
The IUPAC name of 1-butyl-1H-indene;zirconium (CID 175289141) is 1-butyl-1H-indene;zirconium.
What is the SMILES notation for 1-butyl-1H-indene;zirconium?
The canonical SMILES for 1-butyl-1H-indene;zirconium is CCCCC1C=Cc2ccccc21.[Zr].
What is the InChIKey of 1-butyl-1H-indene;zirconium?
The InChIKey is XQKHTLXNHMPANS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16.Zr/c1-2-3-6-11-9-10-12-7-4-5-8-13(11)12;/h4-5,7-11H,2-3,6H2,1H3;.
What are the key properties of 1-butyl-1H-indene;zirconium?
1-butyl-1H-indene;zirconium has a molecular weight of 263.50 g/mol, XLogP of 3.98, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1H-indene;zirconium is sourced from PubChem (CID 175289141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).