About 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+)
1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+) (PubChem CID 173133840) has the molecular formula C24H26Zr
and a molecular weight of 405.70 g/mol. Its IUPAC name is 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+).
Molecular Properties
| Compound Name | 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+) |
| PubChem CID | 173133840 |
| Molecular Formula | C24H26Zr |
| Molecular Weight | 405.70 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+) |
| SMILES | CC[CH-]CCC1C=Cc2ccccc21.[CH2-]C1C=Cc2ccccc21.[Zr+2] |
| InChI | InChI=1S/C14H17.C10H9.Zr/c1-2-3-4-7-12-10-11-13-8-5-6-9-14(12)13;1-8-6-7-9-4-2-3-5-10(8)9;/h3,5-6,8-12H,2,4,7H2,1H3;2-8H,1H2;/q2*-1;+2 |
| InChIKey | UVPUOTUNRTXHDL-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.70 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+)?
The IUPAC name of 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+) (CID 173133840) is 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+).
What is the SMILES notation for 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+)?
The canonical SMILES for 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+) is CC[CH-]CCC1C=Cc2ccccc21.[CH2-]C1C=Cc2ccccc21.[Zr+2].
What is the InChIKey of 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+)?
The InChIKey is UVPUOTUNRTXHDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17.C10H9.Zr/c1-2-3-4-7-12-10-11-13-8-5-6-9-14(12)13;1-8-6-7-9-4-2-3-5-10(8)9;/h3,5-6,8-12H,2,4,7H2,1H3;2-8H,1H2;/q2*-1;+2.
What are the key properties of 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+)?
1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+) has a molecular weight of 405.70 g/mol, XLogP of 6.82, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methanidyl-1H-indene;1-pentyl-1H-indene;zirconium(2+) is sourced from PubChem (CID 173133840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).