About 1-methanidyl-1H-indene;zirconium
1-methanidyl-1H-indene;zirconium (PubChem CID 172710761) has the molecular formula C10H9Zr-
and a molecular weight of 220.41 g/mol. Its IUPAC name is 1-methanidyl-1H-indene;zirconium.
Molecular Properties
| Compound Name | 1-methanidyl-1H-indene;zirconium |
| PubChem CID | 172710761 |
| Molecular Formula | C10H9Zr- |
| Molecular Weight | 220.41 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | 1-methanidyl-1H-indene;zirconium |
| SMILES | [CH2-]C1C=Cc2ccccc21.[Zr] |
| InChI | InChI=1S/C10H9.Zr/c1-8-6-7-9-4-2-3-5-10(8)9;/h2-8H,1H2;/q-1; |
| InChIKey | XITOLHQBZLQUQM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methanidyl-1H-indene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methanidyl-1H-indene;zirconium?
The IUPAC name of 1-methanidyl-1H-indene;zirconium (CID 172710761) is 1-methanidyl-1H-indene;zirconium.
What is the SMILES notation for 1-methanidyl-1H-indene;zirconium?
The canonical SMILES for 1-methanidyl-1H-indene;zirconium is [CH2-]C1C=Cc2ccccc21.[Zr].
What is the InChIKey of 1-methanidyl-1H-indene;zirconium?
The InChIKey is XITOLHQBZLQUQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9.Zr/c1-8-6-7-9-4-2-3-5-10(8)9;/h2-8H,1H2;/q-1;.
What are the key properties of 1-methanidyl-1H-indene;zirconium?
1-methanidyl-1H-indene;zirconium has a molecular weight of 220.41 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methanidyl-1H-indene;zirconium is sourced from PubChem (CID 172710761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).