About 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium
1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium (PubChem CID 162275229) has the molecular formula C23H25Zr-
and a molecular weight of 392.68 g/mol. Its IUPAC name is 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium.
Molecular Properties
| Compound Name | 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium |
| PubChem CID | 162275229 |
| Molecular Formula | C23H25Zr- |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium |
| SMILES | C1=CC(CCC2C=Cc3ccccc32)c2ccccc21.C[CH-]C.[Zr] |
| InChI | InChI=1S/C20H18.C3H7.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;1-3-2;/h1-12,17-18H,13-14H2;3H,1-2H3;/q;-1; |
| InChIKey | AUZZKZPOUJWQIW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium?
The IUPAC name of 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium (CID 162275229) is 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium.
What is the SMILES notation for 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium?
The canonical SMILES for 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium is C1=CC(CCC2C=Cc3ccccc32)c2ccccc21.C[CH-]C.[Zr].
What is the InChIKey of 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium?
The InChIKey is AUZZKZPOUJWQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18.C3H7.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;1-3-2;/h1-12,17-18H,13-14H2;3H,1-2H3;/q;-1;.
What are the key properties of 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium?
1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium has a molecular weight of 392.68 g/mol, XLogP of 6.62, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1H-inden-1-yl)ethyl]-1H-indene;propane;zirconium is sourced from PubChem (CID 162275229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).