About 1H-inden-1-ylmethanamine;hydrochloride
1H-inden-1-ylmethanamine;hydrochloride (PubChem CID 67915005) has the molecular formula C10H12ClN
and a molecular weight of 181.67 g/mol. Its IUPAC name is 1H-inden-1-ylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1H-inden-1-ylmethanamine;hydrochloride |
| PubChem CID | 67915005 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 1H-inden-1-ylmethanamine;hydrochloride |
| SMILES | Cl.NCC1C=Cc2ccccc21 |
| InChI | InChI=1S/C10H11N.ClH/c11-7-9-6-5-8-3-1-2-4-10(8)9;/h1-6,9H,7,11H2;1H |
| InChIKey | JAJCMANRIRVZMW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-inden-1-ylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-1-ylmethanamine;hydrochloride?
The IUPAC name of 1H-inden-1-ylmethanamine;hydrochloride (CID 67915005) is 1H-inden-1-ylmethanamine;hydrochloride.
What is the SMILES notation for 1H-inden-1-ylmethanamine;hydrochloride?
The canonical SMILES for 1H-inden-1-ylmethanamine;hydrochloride is Cl.NCC1C=Cc2ccccc21.
What is the InChIKey of 1H-inden-1-ylmethanamine;hydrochloride?
The InChIKey is JAJCMANRIRVZMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.ClH/c11-7-9-6-5-8-3-1-2-4-10(8)9;/h1-6,9H,7,11H2;1H.
What are the key properties of 1H-inden-1-ylmethanamine;hydrochloride?
1H-inden-1-ylmethanamine;hydrochloride has a molecular weight of 181.67 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-1-ylmethanamine;hydrochloride is sourced from PubChem (CID 67915005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).