About 1H-inden-1-ylmethanol;zirconium(3+);trichloride
1H-inden-1-ylmethanol;zirconium(3+);trichloride (PubChem CID 160514692) has the molecular formula C10H10Cl3OZr
and a molecular weight of 343.77 g/mol. Its IUPAC name is 1H-inden-1-ylmethanol;zirconium(3+);trichloride.
Molecular Properties
| Compound Name | 1H-inden-1-ylmethanol;zirconium(3+);trichloride |
| PubChem CID | 160514692 |
| Molecular Formula | C10H10Cl3OZr |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 340.88 |
| IUPAC Name | 1H-inden-1-ylmethanol;zirconium(3+);trichloride |
| SMILES | OCC1C=Cc2ccccc21.[Cl-].[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C10H10O.3ClH.Zr/c11-7-9-6-5-8-3-1-2-4-10(8)9;;;;/h1-6,9,11H,7H2;3*1H;/q;;;;+3/p-3 |
| InChIKey | DFLZUSOPTOSIEL-UHFFFAOYSA-K |
| XLogP | -7.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | -7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-inden-1-ylmethanol;zirconium(3+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-1-ylmethanol;zirconium(3+);trichloride?
The IUPAC name of 1H-inden-1-ylmethanol;zirconium(3+);trichloride (CID 160514692) is 1H-inden-1-ylmethanol;zirconium(3+);trichloride.
What is the SMILES notation for 1H-inden-1-ylmethanol;zirconium(3+);trichloride?
The canonical SMILES for 1H-inden-1-ylmethanol;zirconium(3+);trichloride is OCC1C=Cc2ccccc21.[Cl-].[Cl-].[Cl-].[Zr+3].
What is the InChIKey of 1H-inden-1-ylmethanol;zirconium(3+);trichloride?
The InChIKey is DFLZUSOPTOSIEL-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H10O.3ClH.Zr/c11-7-9-6-5-8-3-1-2-4-10(8)9;;;;/h1-6,9,11H,7H2;3*1H;/q;;;;+3/p-3.
What are the key properties of 1H-inden-1-ylmethanol;zirconium(3+);trichloride?
1H-inden-1-ylmethanol;zirconium(3+);trichloride has a molecular weight of 343.77 g/mol, XLogP of -7.20, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-1-ylmethanol;zirconium(3+);trichloride is sourced from PubChem (CID 160514692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).