About 1H-indene-1-sulfinic acid
1H-indene-1-sulfinic acid (PubChem CID 57090010) has the molecular formula C9H8O2S
and a molecular weight of 180.23 g/mol. Its IUPAC name is 1H-indene-1-sulfinic acid.
Molecular Properties
| Compound Name | 1H-indene-1-sulfinic acid |
| PubChem CID | 57090010 |
| Molecular Formula | C9H8O2S |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 1H-indene-1-sulfinic acid |
| SMILES | O=S(O)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C9H8O2S/c10-12(11)9-6-5-7-3-1-2-4-8(7)9/h1-6,9H,(H,10,11) |
| InChIKey | DWLLUCGIJVMORL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1H-indene-1-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indene-1-sulfinic acid?
The IUPAC name of 1H-indene-1-sulfinic acid (CID 57090010) is 1H-indene-1-sulfinic acid.
What is the SMILES notation for 1H-indene-1-sulfinic acid?
The canonical SMILES for 1H-indene-1-sulfinic acid is O=S(O)C1C=Cc2ccccc21.
What is the InChIKey of 1H-indene-1-sulfinic acid?
The InChIKey is DWLLUCGIJVMORL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2S/c10-12(11)9-6-5-7-3-1-2-4-8(7)9/h1-6,9H,(H,10,11).
What are the key properties of 1H-indene-1-sulfinic acid?
1H-indene-1-sulfinic acid has a molecular weight of 180.23 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indene-1-sulfinic acid is sourced from PubChem (CID 57090010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).