About cobalt;1H-inden-1-ylmethanone
cobalt;1H-inden-1-ylmethanone (PubChem CID 150174456) has the molecular formula C10H7CoO-
and a molecular weight of 202.10 g/mol. Its IUPAC name is cobalt;1H-inden-1-ylmethanone.
Molecular Properties
| Compound Name | cobalt;1H-inden-1-ylmethanone |
| PubChem CID | 150174456 |
| Molecular Formula | C10H7CoO- |
| Molecular Weight | 202.10 g/mol |
| Exact Mass | 201.98 |
| IUPAC Name | cobalt;1H-inden-1-ylmethanone |
| SMILES | O=[C-]C1C=Cc2ccccc21.[Co] |
| InChI | InChI=1S/C10H7O.Co/c11-7-9-6-5-8-3-1-2-4-10(8)9;/h1-6,9H;/q-1; |
| InChIKey | VOAWDZZUDNWGKJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.10 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt;1H-inden-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;1H-inden-1-ylmethanone?
The IUPAC name of cobalt;1H-inden-1-ylmethanone (CID 150174456) is cobalt;1H-inden-1-ylmethanone.
What is the SMILES notation for cobalt;1H-inden-1-ylmethanone?
The canonical SMILES for cobalt;1H-inden-1-ylmethanone is O=[C-]C1C=Cc2ccccc21.[Co].
What is the InChIKey of cobalt;1H-inden-1-ylmethanone?
The InChIKey is VOAWDZZUDNWGKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7O.Co/c11-7-9-6-5-8-3-1-2-4-10(8)9;/h1-6,9H;/q-1;.
What are the key properties of cobalt;1H-inden-1-ylmethanone?
cobalt;1H-inden-1-ylmethanone has a molecular weight of 202.10 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;1H-inden-1-ylmethanone is sourced from PubChem (CID 150174456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).