About 1-chloro-1H-indene;titanium;dihydrochloride
1-chloro-1H-indene;titanium;dihydrochloride (PubChem CID 174637282) has the molecular formula C9H9Cl3Ti
and a molecular weight of 271.40 g/mol. Its IUPAC name is 1-chloro-1H-indene;titanium;dihydrochloride.
Molecular Properties
| Compound Name | 1-chloro-1H-indene;titanium;dihydrochloride |
| PubChem CID | 174637282 |
| Molecular Formula | C9H9Cl3Ti |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 269.92 |
| IUPAC Name | 1-chloro-1H-indene;titanium;dihydrochloride |
| SMILES | Cl.Cl.ClC1C=Cc2ccccc21.[Ti] |
| InChI | InChI=1S/C9H7Cl.2ClH.Ti/c10-9-6-5-7-3-1-2-4-8(7)9;;;/h1-6,9H;2*1H; |
| InChIKey | JHXMENCVUGIQME-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1H-indene;titanium;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1H-indene;titanium;dihydrochloride?
The IUPAC name of 1-chloro-1H-indene;titanium;dihydrochloride (CID 174637282) is 1-chloro-1H-indene;titanium;dihydrochloride.
What is the SMILES notation for 1-chloro-1H-indene;titanium;dihydrochloride?
The canonical SMILES for 1-chloro-1H-indene;titanium;dihydrochloride is Cl.Cl.ClC1C=Cc2ccccc21.[Ti].
What is the InChIKey of 1-chloro-1H-indene;titanium;dihydrochloride?
The InChIKey is JHXMENCVUGIQME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl.2ClH.Ti/c10-9-6-5-7-3-1-2-4-8(7)9;;;/h1-6,9H;2*1H;.
What are the key properties of 1-chloro-1H-indene;titanium;dihydrochloride?
1-chloro-1H-indene;titanium;dihydrochloride has a molecular weight of 271.40 g/mol, XLogP of 3.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1H-indene;titanium;dihydrochloride is sourced from PubChem (CID 174637282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).