About 1-chloro-1H-phenalene
1-chloro-1H-phenalene (PubChem CID 118456888) has the molecular formula C13H9Cl
and a molecular weight of 200.67 g/mol. Its IUPAC name is 1-chloro-1H-phenalene.
Molecular Properties
| Compound Name | 1-chloro-1H-phenalene |
| PubChem CID | 118456888 |
| Molecular Formula | C13H9Cl |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-chloro-1H-phenalene |
| SMILES | ClC1C=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C13H9Cl/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8,12H |
| InChIKey | GHEXKNAXILJSDZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1H-phenalene?
The IUPAC name of 1-chloro-1H-phenalene (CID 118456888) is 1-chloro-1H-phenalene.
What is the SMILES notation for 1-chloro-1H-phenalene?
The canonical SMILES for 1-chloro-1H-phenalene is ClC1C=Cc2cccc3cccc1c23.
What is the InChIKey of 1-chloro-1H-phenalene?
The InChIKey is GHEXKNAXILJSDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8,12H.
What are the key properties of 1-chloro-1H-phenalene?
1-chloro-1H-phenalene has a molecular weight of 200.67 g/mol, XLogP of 4.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1H-phenalene is sourced from PubChem (CID 118456888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).