C19H17OP — CID 155317049
3,4-dimethyl-1-(1H-phenalen-1-yl)-1λ5-phosphole 1-oxide (PubChem CID 155317049) has the molecular formula C19H17OP and a molecular weight of 292.32 g/mol. Its IUPAC name is 3,4-dimethyl-1-(1H-phenalen-1-yl)-1λ5-phosphole 1-oxide.
| Compound Name | 3,4-dimethyl-1-(1H-phenalen-1-yl)-1λ5-phosphole 1-oxide |
|---|---|
| PubChem CID | 155317049 |
| Molecular Formula | C19H17OP |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3,4-dimethyl-1-(1H-phenalen-1-yl)-1λ5-phosphole 1-oxide |
| SMILES | CC1=CP(=O)(C2C=Cc3cccc4cccc2c34)C=C1C |
| InChI | InChI=1S/C19H17OP/c1-13-11-21(20,12-14(13)2)18-10-9-16-6-3-5-15-7-4-8-17(18)19(15)16/h3-12,18H,1-2H3 |
| InChIKey | QQYICDNCHNWSGT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|