About acenaphthylene;ethane
acenaphthylene;ethane (PubChem CID 54237459) has the molecular formula C18H26
and a molecular weight of 242.41 g/mol. Its IUPAC name is acenaphthylene;ethane.
Molecular Properties
| Compound Name | acenaphthylene;ethane |
| PubChem CID | 54237459 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | acenaphthylene;ethane |
| SMILES | C1=Cc2cccc3cccc1c23.CC.CC.CC |
| InChI | InChI=1S/C12H8.3C2H6/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;3*1-2/h1-8H;3*1-2H3 |
| InChIKey | QNOVBQQROQCODR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze acenaphthylene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acenaphthylene;ethane?
The IUPAC name of acenaphthylene;ethane (CID 54237459) is acenaphthylene;ethane.
What is the SMILES notation for acenaphthylene;ethane?
The canonical SMILES for acenaphthylene;ethane is C1=Cc2cccc3cccc1c23.CC.CC.CC.
What is the InChIKey of acenaphthylene;ethane?
The InChIKey is QNOVBQQROQCODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.3C2H6/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;3*1-2/h1-8H;3*1-2H3.
What are the key properties of acenaphthylene;ethane?
acenaphthylene;ethane has a molecular weight of 242.41 g/mol, XLogP of 6.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acenaphthylene;ethane is sourced from PubChem (CID 54237459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).