C21H20 — CID 175249677
acenaphthylene;1,3,5-trimethylbenzene (PubChem CID 175249677) has the molecular formula C21H20 and a molecular weight of 272.39 g/mol. Its IUPAC name is acenaphthylene;1,3,5-trimethylbenzene.
| Compound Name | acenaphthylene;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 175249677 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | acenaphthylene;1,3,5-trimethylbenzene |
| SMILES | C1=Cc2cccc3cccc1c23.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H8.C9H12/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;1-7-4-8(2)6-9(3)5-7/h1-8H;4-6H,1-3H3 |
| InChIKey | HFBWYYHCZWSVQL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |