About acenaphthylene;1,3,5-trimethylbenzene
acenaphthylene;1,3,5-trimethylbenzene (PubChem CID 175249677) has the molecular formula C21H20
and a molecular weight of 272.39 g/mol. Its IUPAC name is acenaphthylene;1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | acenaphthylene;1,3,5-trimethylbenzene |
| PubChem CID | 175249677 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | acenaphthylene;1,3,5-trimethylbenzene |
| SMILES | C1=Cc2cccc3cccc1c23.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H8.C9H12/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;1-7-4-8(2)6-9(3)5-7/h1-8H;4-6H,1-3H3 |
| InChIKey | HFBWYYHCZWSVQL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze acenaphthylene;1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acenaphthylene;1,3,5-trimethylbenzene?
The IUPAC name of acenaphthylene;1,3,5-trimethylbenzene (CID 175249677) is acenaphthylene;1,3,5-trimethylbenzene.
What is the SMILES notation for acenaphthylene;1,3,5-trimethylbenzene?
The canonical SMILES for acenaphthylene;1,3,5-trimethylbenzene is C1=Cc2cccc3cccc1c23.Cc1cc(C)cc(C)c1.
What is the InChIKey of acenaphthylene;1,3,5-trimethylbenzene?
The InChIKey is HFBWYYHCZWSVQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.C9H12/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;1-7-4-8(2)6-9(3)5-7/h1-8H;4-6H,1-3H3.
What are the key properties of acenaphthylene;1,3,5-trimethylbenzene?
acenaphthylene;1,3,5-trimethylbenzene has a molecular weight of 272.39 g/mol, XLogP of 5.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acenaphthylene;1,3,5-trimethylbenzene is sourced from PubChem (CID 175249677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).