About acenaphthylene;fluoranthene;furan
acenaphthylene;fluoranthene;furan (PubChem CID 158545745) has the molecular formula C32H22O
and a molecular weight of 422.53 g/mol. Its IUPAC name is acenaphthylene;fluoranthene;furan.
Molecular Properties
| Compound Name | acenaphthylene;fluoranthene;furan |
| PubChem CID | 158545745 |
| Molecular Formula | C32H22O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | acenaphthylene;fluoranthene;furan |
| SMILES | C1=Cc2cccc3cccc1c23.c1ccc2c(c1)-c1cccc3cccc-2c13.c1ccoc1 |
| InChI | InChI=1S/C16H10.C12H8.C4H4O/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;1-2-4-5-3-1/h1-10H;1-8H;1-4H |
| InChIKey | HPBYGMDYONTVEP-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acenaphthylene;fluoranthene;furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acenaphthylene;fluoranthene;furan?
The IUPAC name of acenaphthylene;fluoranthene;furan (CID 158545745) is acenaphthylene;fluoranthene;furan.
What is the SMILES notation for acenaphthylene;fluoranthene;furan?
The canonical SMILES for acenaphthylene;fluoranthene;furan is C1=Cc2cccc3cccc1c23.c1ccc2c(c1)-c1cccc3cccc-2c13.c1ccoc1.
What is the InChIKey of acenaphthylene;fluoranthene;furan?
The InChIKey is HPBYGMDYONTVEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C12H8.C4H4O/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;1-2-4-5-3-1/h1-10H;1-8H;1-4H.
What are the key properties of acenaphthylene;fluoranthene;furan?
acenaphthylene;fluoranthene;furan has a molecular weight of 422.53 g/mol, XLogP of 9.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acenaphthylene;fluoranthene;furan is sourced from PubChem (CID 158545745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).