About fluoranthene;toluene
fluoranthene;toluene (PubChem CID 173324369) has the molecular formula C23H18
and a molecular weight of 294.40 g/mol. Its IUPAC name is fluoranthene;toluene.
Molecular Properties
| Compound Name | fluoranthene;toluene |
| PubChem CID | 173324369 |
| Molecular Formula | C23H18 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | fluoranthene;toluene |
| SMILES | Cc1ccccc1.c1ccc2c(c1)-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C16H10.C7H8/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;1-7-5-3-2-4-6-7/h1-10H;2-6H,1H3 |
| InChIKey | PZCRYFWVLBCERS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze fluoranthene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoranthene;toluene?
The IUPAC name of fluoranthene;toluene (CID 173324369) is fluoranthene;toluene.
What is the SMILES notation for fluoranthene;toluene?
The canonical SMILES for fluoranthene;toluene is Cc1ccccc1.c1ccc2c(c1)-c1cccc3cccc-2c13.
What is the InChIKey of fluoranthene;toluene?
The InChIKey is PZCRYFWVLBCERS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C7H8/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;1-7-5-3-2-4-6-7/h1-10H;2-6H,1H3.
What are the key properties of fluoranthene;toluene?
fluoranthene;toluene has a molecular weight of 294.40 g/mol, XLogP of 6.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoranthene;toluene is sourced from PubChem (CID 173324369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).