About ethane;fluoranthene;triphenylene
ethane;fluoranthene;triphenylene (PubChem CID 160720447) has the molecular formula C38H34
and a molecular weight of 490.69 g/mol. Its IUPAC name is ethane;fluoranthene;triphenylene.
Molecular Properties
| Compound Name | ethane;fluoranthene;triphenylene |
| PubChem CID | 160720447 |
| Molecular Formula | C38H34 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | ethane;fluoranthene;triphenylene |
| SMILES | CC.CC.c1ccc2c(c1)-c1cccc3cccc-2c13.c1ccc2c(c1)c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C18H12.C16H10.2C2H6/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;2*1-2/h1-12H;1-10H;2*1-2H3 |
| InChIKey | RTANKEDAFMEIGY-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze ethane;fluoranthene;triphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;fluoranthene;triphenylene?
The IUPAC name of ethane;fluoranthene;triphenylene (CID 160720447) is ethane;fluoranthene;triphenylene.
What is the SMILES notation for ethane;fluoranthene;triphenylene?
The canonical SMILES for ethane;fluoranthene;triphenylene is CC.CC.c1ccc2c(c1)-c1cccc3cccc-2c13.c1ccc2c(c1)c1ccccc1c1ccccc21.
What is the InChIKey of ethane;fluoranthene;triphenylene?
The InChIKey is RTANKEDAFMEIGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.C16H10.2C2H6/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;2*1-2/h1-12H;1-10H;2*1-2H3.
What are the key properties of ethane;fluoranthene;triphenylene?
ethane;fluoranthene;triphenylene has a molecular weight of 490.69 g/mol, XLogP of 11.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;fluoranthene;triphenylene is sourced from PubChem (CID 160720447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).