C31H18O3 — CID 157197753
anthracene-9,10-dione;benzo[a]phenalen-7-one (PubChem CID 157197753) has the molecular formula C31H18O3 and a molecular weight of 438.48 g/mol. Its IUPAC name is anthracene-9,10-dione;benzo[a]phenalen-7-one.
| Compound Name | anthracene-9,10-dione;benzo[a]phenalen-7-one |
|---|---|
| PubChem CID | 157197753 |
| Molecular Formula | C31H18O3 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | anthracene-9,10-dione;benzo[a]phenalen-7-one |
| SMILES | O=C1c2ccccc2-c2cccc3cccc1c23.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H10O.C14H8O2/c18-17-14-8-2-1-7-12(14)13-9-3-5-11-6-4-10-15(17)16(11)13;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-10H;1-8H |
| InChIKey | AQLFGRHORHMOCW-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|