C17H10O2S — CID 13402446
2-oxo-2lambda4-thiatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,10,12,14(18),15-octaen-9-one (PubChem CID 13402446) has the molecular formula C17H10O2S and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-oxo-2lambda4-thiatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,10,12,14(18),15-octaen-9-one.
| Compound Name | 2-oxo-2lambda4-thiatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,10,12,14(18),15-octaen-9-one |
|---|---|
| PubChem CID | 13402446 |
| Molecular Formula | C17H10O2S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-oxo-2lambda4-thiatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,10,12,14(18),15-octaen-9-one |
| SMILES | O=C1c2ccccc2S(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C17H10O2S/c18-17-12-7-1-2-9-14(12)20(19)15-10-4-6-11-5-3-8-13(17)16(11)15/h1-10H |
| InChIKey | ALUZHULUDFCXEP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |